About propane;thiolane;2,4,5-trimethyl-1,3-oxazole
propane;thiolane;2,4,5-trimethyl-1,3-oxazole (PubChem CID 91247463) has the molecular formula C13H25NOS
and a molecular weight of 243.42 g/mol. Its IUPAC name is propane;thiolane;2,4,5-trimethyl-1,3-oxazole.
Molecular Properties
| Compound Name | propane;thiolane;2,4,5-trimethyl-1,3-oxazole |
| PubChem CID | 91247463 |
| Molecular Formula | C13H25NOS |
| Molecular Weight | 243.42 g/mol |
| Exact Mass | 243.17 |
| IUPAC Name | propane;thiolane;2,4,5-trimethyl-1,3-oxazole |
| SMILES | C1CCSC1.CCC.Cc1nc(C)c(C)o1 |
| InChI | InChI=1S/C6H9NO.C4H8S.C3H8/c1-4-5(2)8-6(3)7-4;1-2-4-5-3-1;1-3-2/h1-3H3;1-4H2;3H2,1-2H3 |
| InChIKey | WRKRQHJBPQSKPS-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.42 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze propane;thiolane;2,4,5-trimethyl-1,3-oxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propane;thiolane;2,4,5-trimethyl-1,3-oxazole?
The IUPAC name of propane;thiolane;2,4,5-trimethyl-1,3-oxazole (CID 91247463) is propane;thiolane;2,4,5-trimethyl-1,3-oxazole.
What is the SMILES notation for propane;thiolane;2,4,5-trimethyl-1,3-oxazole?
The canonical SMILES for propane;thiolane;2,4,5-trimethyl-1,3-oxazole is C1CCSC1.CCC.Cc1nc(C)c(C)o1.
What is the InChIKey of propane;thiolane;2,4,5-trimethyl-1,3-oxazole?
The InChIKey is WRKRQHJBPQSKPS-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9NO.C4H8S.C3H8/c1-4-5(2)8-6(3)7-4;1-2-4-5-3-1;1-3-2/h1-3H3;1-4H2;3H2,1-2H3.
What are the key properties of propane;thiolane;2,4,5-trimethyl-1,3-oxazole?
propane;thiolane;2,4,5-trimethyl-1,3-oxazole has a molecular weight of 243.42 g/mol, XLogP of 4.53, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for propane;thiolane;2,4,5-trimethyl-1,3-oxazole is sourced from PubChem (CID 91247463), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).