C32H49N7O3 — CID 91247819
N-(3-cyano-1-cyclohexylpyrrolidin-3-yl)-2-[cyclohexyl(1H-pyrrol-2-yl)methyl]-3-(ethylcarbamoylimino)-3-morpholin-4-ylpropanamide (PubChem CID 91247819) has the molecular formula C32H49N7O3 and a molecular weight of 579.79 g/mol. Its IUPAC name is N-(3-cyano-1-cyclohexylpyrrolidin-3-yl)-2-[cyclohexyl(1H-pyrrol-2-yl)methyl]-3-(ethylcarbamoylimino)-3-morpholin-4-ylpropanamide.
| Compound Name | N-(3-cyano-1-cyclohexylpyrrolidin-3-yl)-2-[cyclohexyl(1H-pyrrol-2-yl)methyl]-3-(ethylcarbamoylimino)-3-morpholin-4-ylpropanamide |
|---|---|
| PubChem CID | 91247819 |
| Molecular Formula | C32H49N7O3 |
| Molecular Weight | 579.79 g/mol |
| Exact Mass | 579.39 |
| IUPAC Name | N-(3-cyano-1-cyclohexylpyrrolidin-3-yl)-2-[cyclohexyl(1H-pyrrol-2-yl)methyl]-3-(ethylcarbamoylimino)-3-morpholin-4-ylpropanamide |
| SMILES | CCNC(=O)N=C(C(C(=O)NC1(C#N)CCN(C2CCCCC2)C1)C(c1ccc[nH]1)C1CCCCC1)N1CCOCC1 |
| InChI | InChI=1S/C32H49N7O3/c1-2-34-31(41)36-29(38-18-20-42-21-19-38)28(27(26-14-9-16-35-26)24-10-5-3-6-11-24)30(40)37-32(22-33)15-17-39(23-32)25-12-7-4-8-13-25/h9,14,16,24-25,27-28,35H,2-8,10-13,15,17-21,23H2,1H3,(H,34,41)(H,37,40) |
| InChIKey | KNBTZKXEUIFQDC-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 125.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.79 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|