C6H6N4OS — CID 91248085
5-(1,2,4-oxadiazol-5-yl)-5,6-dihydro-1H-pyrimidine-2-thione (PubChem CID 91248085) has the molecular formula C6H6N4OS and a molecular weight of 182.21 g/mol. Its IUPAC name is 5-(1,2,4-oxadiazol-5-yl)-5,6-dihydro-1H-pyrimidine-2-thione.
| Compound Name | 5-(1,2,4-oxadiazol-5-yl)-5,6-dihydro-1H-pyrimidine-2-thione |
|---|---|
| PubChem CID | 91248085 |
| Molecular Formula | C6H6N4OS |
| Molecular Weight | 182.21 g/mol |
| Exact Mass | 182.03 |
| IUPAC Name | 5-(1,2,4-oxadiazol-5-yl)-5,6-dihydro-1H-pyrimidine-2-thione |
| SMILES | S=C1N=CC(c2ncno2)CN1 |
| InChI | InChI=1S/C6H6N4OS/c12-6-7-1-4(2-8-6)5-9-3-10-11-5/h1,3-4H,2H2,(H,8,12) |
| InChIKey | YVNYVYLMOLUULU-UHFFFAOYSA-N |
| XLogP | 0.11 |
| TPSA | 63.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.21 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|