About 4-butylmorpholine;N,N-diethyl-4-methylpentan-1-amine
4-butylmorpholine;N,N-diethyl-4-methylpentan-1-amine (PubChem CID 91248869) has the molecular formula C18H40N2O
and a molecular weight of 300.53 g/mol. Its IUPAC name is 4-butylmorpholine;N,N-diethyl-4-methylpentan-1-amine.
Molecular Properties
| Compound Name | 4-butylmorpholine;N,N-diethyl-4-methylpentan-1-amine |
| PubChem CID | 91248869 |
| Molecular Formula | C18H40N2O |
| Molecular Weight | 300.53 g/mol |
| Exact Mass | 300.31 |
| IUPAC Name | 4-butylmorpholine;N,N-diethyl-4-methylpentan-1-amine |
| SMILES | CCCCN1CCOCC1.CCN(CC)CCCC(C)C |
| InChI | InChI=1S/C10H23N.C8H17NO/c1-5-11(6-2)9-7-8-10(3)4;1-2-3-4-9-5-7-10-8-6-9/h10H,5-9H2,1-4H3;2-8H2,1H3 |
| InChIKey | JRQQOMOQEOTVOJ-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 300.53 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-butylmorpholine;N,N-diethyl-4-methylpentan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-butylmorpholine;N,N-diethyl-4-methylpentan-1-amine?
The IUPAC name of 4-butylmorpholine;N,N-diethyl-4-methylpentan-1-amine (CID 91248869) is 4-butylmorpholine;N,N-diethyl-4-methylpentan-1-amine.
What is the SMILES notation for 4-butylmorpholine;N,N-diethyl-4-methylpentan-1-amine?
The canonical SMILES for 4-butylmorpholine;N,N-diethyl-4-methylpentan-1-amine is CCCCN1CCOCC1.CCN(CC)CCCC(C)C.
What is the InChIKey of 4-butylmorpholine;N,N-diethyl-4-methylpentan-1-amine?
The InChIKey is JRQQOMOQEOTVOJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H23N.C8H17NO/c1-5-11(6-2)9-7-8-10(3)4;1-2-3-4-9-5-7-10-8-6-9/h10H,5-9H2,1-4H3;2-8H2,1H3.
What are the key properties of 4-butylmorpholine;N,N-diethyl-4-methylpentan-1-amine?
4-butylmorpholine;N,N-diethyl-4-methylpentan-1-amine has a molecular weight of 300.53 g/mol, XLogP of 3.88, 9 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-butylmorpholine;N,N-diethyl-4-methylpentan-1-amine is sourced from PubChem (CID 91248869), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).