C16H14F3N3O3 — CID 91249013
N-[(1S,2R,4R)-7-azabicyclo[2.2.1]heptan-2-yl]-2-(2,2,2-trifluoroacetyl)furo[3,2-c]pyridine-6-carboxamide (PubChem CID 91249013) has the molecular formula C16H14F3N3O3 and a molecular weight of 353.30 g/mol. Its IUPAC name is N-[(1S,2R,4R)-7-azabicyclo[2.2.1]heptan-2-yl]-2-(2,2,2-trifluoroacetyl)furo[3,2-c]pyridine-6-carboxamide.
| Compound Name | N-[(1S,2R,4R)-7-azabicyclo[2.2.1]heptan-2-yl]-2-(2,2,2-trifluoroacetyl)furo[3,2-c]pyridine-6-carboxamide |
|---|---|
| PubChem CID | 91249013 |
| Molecular Formula | C16H14F3N3O3 |
| Molecular Weight | 353.30 g/mol |
| Exact Mass | 353.10 |
| IUPAC Name | N-[(1S,2R,4R)-7-azabicyclo[2.2.1]heptan-2-yl]-2-(2,2,2-trifluoroacetyl)furo[3,2-c]pyridine-6-carboxamide |
| SMILES | O=C(N[C@@H]1C[C@H]2CC[C@@H]1N2)c1cc2oc(C(=O)C(F)(F)F)cc2cn1 |
| InChI | InChI=1S/C16H14F3N3O3/c17-16(18,19)14(23)13-3-7-6-20-11(5-12(7)25-13)15(24)22-10-4-8-1-2-9(10)21-8/h3,5-6,8-10,21H,1-2,4H2,(H,22,24)/t8-,9+,10-/m1/s1 |
| InChIKey | GCXKYIYAMZPQBD-KXUCPTDWSA-N |
| XLogP | 2.20 |
| TPSA | 84.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.30 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |