About 6-oxaspiro[3.6]dec-2-ene
6-oxaspiro[3.6]dec-2-ene (PubChem CID 91249084) has the molecular formula C9H14O
and a molecular weight of 138.21 g/mol. Its IUPAC name is 6-oxaspiro[3.6]dec-2-ene.
Molecular Properties
| Compound Name | 6-oxaspiro[3.6]dec-2-ene |
| PubChem CID | 91249084 |
| Molecular Formula | C9H14O |
| Molecular Weight | 138.21 g/mol |
| Exact Mass | 138.10 |
| IUPAC Name | 6-oxaspiro[3.6]dec-2-ene |
| SMILES | C1=CC2(C1)CCCCOC2 |
| InChI | InChI=1S/C9H14O/c1-2-7-10-8-9(4-1)5-3-6-9/h3,5H,1-2,4,6-8H2 |
| InChIKey | ODWNQXOFGKGANU-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 138.21 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 6-oxaspiro[3.6]dec-2-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-oxaspiro[3.6]dec-2-ene?
The IUPAC name of 6-oxaspiro[3.6]dec-2-ene (CID 91249084) is 6-oxaspiro[3.6]dec-2-ene.
What is the SMILES notation for 6-oxaspiro[3.6]dec-2-ene?
The canonical SMILES for 6-oxaspiro[3.6]dec-2-ene is C1=CC2(C1)CCCCOC2.
What is the InChIKey of 6-oxaspiro[3.6]dec-2-ene?
The InChIKey is ODWNQXOFGKGANU-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14O/c1-2-7-10-8-9(4-1)5-3-6-9/h3,5H,1-2,4,6-8H2.
What are the key properties of 6-oxaspiro[3.6]dec-2-ene?
6-oxaspiro[3.6]dec-2-ene has a molecular weight of 138.21 g/mol, XLogP of 2.13, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 6-oxaspiro[3.6]dec-2-ene is sourced from PubChem (CID 91249084), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).