C19H14F3N5O4S — CID 91249207
5,6-dimethoxy-N-(2H-tetrazol-5-yl)-3-[(2,3,6-trifluorophenyl)methoxy]-1-benzothiophene-2-carboxamide (PubChem CID 91249207) has the molecular formula C19H14F3N5O4S and a molecular weight of 465.41 g/mol. Its IUPAC name is 5,6-dimethoxy-N-(2H-tetrazol-5-yl)-3-[(2,3,6-trifluorophenyl)methoxy]-1-benzothiophene-2-carboxamide.
| Compound Name | 5,6-dimethoxy-N-(2H-tetrazol-5-yl)-3-[(2,3,6-trifluorophenyl)methoxy]-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 91249207 |
| Molecular Formula | C19H14F3N5O4S |
| Molecular Weight | 465.41 g/mol |
| Exact Mass | 465.07 |
| IUPAC Name | 5,6-dimethoxy-N-(2H-tetrazol-5-yl)-3-[(2,3,6-trifluorophenyl)methoxy]-1-benzothiophene-2-carboxamide |
| SMILES | COc1cc2sc(C(=O)Nc3nn[nH]n3)c(OCc3c(F)ccc(F)c3F)c2cc1OC |
| InChI | InChI=1S/C19H14F3N5O4S/c1-29-12-5-8-14(6-13(12)30-2)32-17(18(28)23-19-24-26-27-25-19)16(8)31-7-9-10(20)3-4-11(21)15(9)22/h3-6H,7H2,1-2H3,(H2,23,24,25,26,27,28) |
| InChIKey | STPPYPFTQKCPNK-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 111.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.41 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|