C15H24O4 — CID 91249302
methyl 2-[(8R,9R)-9-pent-2-enyl-1,4-dioxaspiro[4.4]nonan-8-yl]acetate (PubChem CID 91249302) has the molecular formula C15H24O4 and a molecular weight of 268.35 g/mol. Its IUPAC name is methyl 2-[(8R,9R)-9-pent-2-enyl-1,4-dioxaspiro[4.4]nonan-8-yl]acetate.
| Compound Name | methyl 2-[(8R,9R)-9-pent-2-enyl-1,4-dioxaspiro[4.4]nonan-8-yl]acetate |
|---|---|
| PubChem CID | 91249302 |
| Molecular Formula | C15H24O4 |
| Molecular Weight | 268.35 g/mol |
| Exact Mass | 268.17 |
| IUPAC Name | methyl 2-[(8R,9R)-9-pent-2-enyl-1,4-dioxaspiro[4.4]nonan-8-yl]acetate |
| SMILES | CCC=CC[C@@H]1[C@@H](CC(=O)OC)CCC12OCCO2 |
| InChI | InChI=1S/C15H24O4/c1-3-4-5-6-13-12(11-14(16)17-2)7-8-15(13)18-9-10-19-15/h4-5,12-13H,3,6-11H2,1-2H3/t12-,13-/m1/s1 |
| InChIKey | XYBKWAWRVAJPAZ-CHWSQXEVSA-N |
| XLogP | 2.68 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.35 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|