About bis(hepta-1,3,5-trien-4-yloxy)-methylphosphane
bis(hepta-1,3,5-trien-4-yloxy)-methylphosphane (PubChem CID 91249339) has the molecular formula C15H21O2P
and a molecular weight of 264.31 g/mol. Its IUPAC name is bis(hepta-1,3,5-trien-4-yloxy)-methylphosphane.
Molecular Properties
| Compound Name | bis(hepta-1,3,5-trien-4-yloxy)-methylphosphane |
| PubChem CID | 91249339 |
| Molecular Formula | C15H21O2P |
| Molecular Weight | 264.31 g/mol |
| Exact Mass | 264.13 |
| IUPAC Name | bis(hepta-1,3,5-trien-4-yloxy)-methylphosphane |
| SMILES | C=CC=C(C=CC)OP(C)OC(C=CC)=CC=C |
| InChI | InChI=1S/C15H21O2P/c1-6-10-14(11-7-2)16-18(5)17-15(12-8-3)13-9-4/h6-13H,1,3H2,2,4-5H3 |
| InChIKey | FGTYPKJXJUFZAP-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 264.31 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze bis(hepta-1,3,5-trien-4-yloxy)-methylphosphane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(hepta-1,3,5-trien-4-yloxy)-methylphosphane?
The IUPAC name of bis(hepta-1,3,5-trien-4-yloxy)-methylphosphane (CID 91249339) is bis(hepta-1,3,5-trien-4-yloxy)-methylphosphane.
What is the SMILES notation for bis(hepta-1,3,5-trien-4-yloxy)-methylphosphane?
The canonical SMILES for bis(hepta-1,3,5-trien-4-yloxy)-methylphosphane is C=CC=C(C=CC)OP(C)OC(C=CC)=CC=C.
What is the InChIKey of bis(hepta-1,3,5-trien-4-yloxy)-methylphosphane?
The InChIKey is FGTYPKJXJUFZAP-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H21O2P/c1-6-10-14(11-7-2)16-18(5)17-15(12-8-3)13-9-4/h6-13H,1,3H2,2,4-5H3.
What are the key properties of bis(hepta-1,3,5-trien-4-yloxy)-methylphosphane?
bis(hepta-1,3,5-trien-4-yloxy)-methylphosphane has a molecular weight of 264.31 g/mol, XLogP of 5.25, 8 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for bis(hepta-1,3,5-trien-4-yloxy)-methylphosphane is sourced from PubChem (CID 91249339), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).