C13H11BrN2OS — CID 91249630
3-bromo-4-methyl-5-(2-phenyl-1,3-thiazol-5-yl)-2,5-dihydro-1,2-oxazole (PubChem CID 91249630) has the molecular formula C13H11BrN2OS and a molecular weight of 323.22 g/mol. Its IUPAC name is 3-bromo-4-methyl-5-(2-phenyl-1,3-thiazol-5-yl)-2,5-dihydro-1,2-oxazole.
| Compound Name | 3-bromo-4-methyl-5-(2-phenyl-1,3-thiazol-5-yl)-2,5-dihydro-1,2-oxazole |
|---|---|
| PubChem CID | 91249630 |
| Molecular Formula | C13H11BrN2OS |
| Molecular Weight | 323.22 g/mol |
| Exact Mass | 321.98 |
| IUPAC Name | 3-bromo-4-methyl-5-(2-phenyl-1,3-thiazol-5-yl)-2,5-dihydro-1,2-oxazole |
| SMILES | CC1=C(Br)NOC1c1cnc(-c2ccccc2)s1 |
| InChI | InChI=1S/C13H11BrN2OS/c1-8-11(17-16-12(8)14)10-7-15-13(18-10)9-5-3-2-4-6-9/h2-7,11,16H,1H3 |
| InChIKey | MCZMIZZTOKBYOW-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.22 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|