About 2-(cyclohexyloxymethyl)-2,3-dihydrothiophene
2-(cyclohexyloxymethyl)-2,3-dihydrothiophene (PubChem CID 91249774) has the molecular formula C11H18OS
and a molecular weight of 198.33 g/mol. Its IUPAC name is 2-(cyclohexyloxymethyl)-2,3-dihydrothiophene.
Molecular Properties
| Compound Name | 2-(cyclohexyloxymethyl)-2,3-dihydrothiophene |
| PubChem CID | 91249774 |
| Molecular Formula | C11H18OS |
| Molecular Weight | 198.33 g/mol |
| Exact Mass | 198.11 |
| IUPAC Name | 2-(cyclohexyloxymethyl)-2,3-dihydrothiophene |
| SMILES | C1=CSC(COC2CCCCC2)C1 |
| InChI | InChI=1S/C11H18OS/c1-2-5-10(6-3-1)12-9-11-7-4-8-13-11/h4,8,10-11H,1-3,5-7,9H2 |
| InChIKey | JHUCYNHKZWUHRZ-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.33 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-(cyclohexyloxymethyl)-2,3-dihydrothiophene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(cyclohexyloxymethyl)-2,3-dihydrothiophene?
The IUPAC name of 2-(cyclohexyloxymethyl)-2,3-dihydrothiophene (CID 91249774) is 2-(cyclohexyloxymethyl)-2,3-dihydrothiophene.
What is the SMILES notation for 2-(cyclohexyloxymethyl)-2,3-dihydrothiophene?
The canonical SMILES for 2-(cyclohexyloxymethyl)-2,3-dihydrothiophene is C1=CSC(COC2CCCCC2)C1.
What is the InChIKey of 2-(cyclohexyloxymethyl)-2,3-dihydrothiophene?
The InChIKey is JHUCYNHKZWUHRZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18OS/c1-2-5-10(6-3-1)12-9-11-7-4-8-13-11/h4,8,10-11H,1-3,5-7,9H2.
What are the key properties of 2-(cyclohexyloxymethyl)-2,3-dihydrothiophene?
2-(cyclohexyloxymethyl)-2,3-dihydrothiophene has a molecular weight of 198.33 g/mol, XLogP of 3.35, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(cyclohexyloxymethyl)-2,3-dihydrothiophene is sourced from PubChem (CID 91249774), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).