C11H16F3N — CID 91250232
(3E,5Z)-9,9,9-trifluoro-4,8-dimethylnona-3,5-dien-2-imine (PubChem CID 91250232) has the molecular formula C11H16F3N and a molecular weight of 219.25 g/mol. Its IUPAC name is (3E,5Z)-9,9,9-trifluoro-4,8-dimethylnona-3,5-dien-2-imine.
| Compound Name | (3E,5Z)-9,9,9-trifluoro-4,8-dimethylnona-3,5-dien-2-imine |
|---|---|
| PubChem CID | 91250232 |
| Molecular Formula | C11H16F3N |
| Molecular Weight | 219.25 g/mol |
| Exact Mass | 219.12 |
| IUPAC Name | (3E,5Z)-9,9,9-trifluoro-4,8-dimethylnona-3,5-dien-2-imine |
| SMILES | [H]/N=C(C)/C=C(C)/C=C\CC(C)C(F)(F)F |
| InChI | InChI=1S/C11H16F3N/c1-8(7-10(3)15)5-4-6-9(2)11(12,13)14/h4-5,7,9,15H,6H2,1-3H3/b5-4-,8-7+,15-10+ |
| InChIKey | DQLQPRRUEUGISL-LPYQIECWSA-N |
| XLogP | 4.12 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.25 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|