About 1-(aminomethyl)-2,5-dihydropyrrole-2,5-diol
1-(aminomethyl)-2,5-dihydropyrrole-2,5-diol (PubChem CID 91250484) has the molecular formula C5H10N2O2
and a molecular weight of 130.15 g/mol. Its IUPAC name is 1-(aminomethyl)-2,5-dihydropyrrole-2,5-diol.
Molecular Properties
| Compound Name | 1-(aminomethyl)-2,5-dihydropyrrole-2,5-diol |
| PubChem CID | 91250484 |
| Molecular Formula | C5H10N2O2 |
| Molecular Weight | 130.15 g/mol |
| Exact Mass | 130.07 |
| IUPAC Name | 1-(aminomethyl)-2,5-dihydropyrrole-2,5-diol |
| SMILES | NCN1C(O)C=CC1O |
| InChI | InChI=1S/C5H10N2O2/c6-3-7-4(8)1-2-5(7)9/h1-2,4-5,8-9H,3,6H2 |
| InChIKey | TYYZBOMNXMPRBZ-UHFFFAOYSA-N |
| XLogP | -1.59 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 130.15 |
| LogP ≤ 5 | -1.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-(aminomethyl)-2,5-dihydropyrrole-2,5-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(aminomethyl)-2,5-dihydropyrrole-2,5-diol?
The IUPAC name of 1-(aminomethyl)-2,5-dihydropyrrole-2,5-diol (CID 91250484) is 1-(aminomethyl)-2,5-dihydropyrrole-2,5-diol.
What is the SMILES notation for 1-(aminomethyl)-2,5-dihydropyrrole-2,5-diol?
The canonical SMILES for 1-(aminomethyl)-2,5-dihydropyrrole-2,5-diol is NCN1C(O)C=CC1O.
What is the InChIKey of 1-(aminomethyl)-2,5-dihydropyrrole-2,5-diol?
The InChIKey is TYYZBOMNXMPRBZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H10N2O2/c6-3-7-4(8)1-2-5(7)9/h1-2,4-5,8-9H,3,6H2.
What are the key properties of 1-(aminomethyl)-2,5-dihydropyrrole-2,5-diol?
1-(aminomethyl)-2,5-dihydropyrrole-2,5-diol has a molecular weight of 130.15 g/mol, XLogP of -1.59, 1 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(aminomethyl)-2,5-dihydropyrrole-2,5-diol is sourced from PubChem (CID 91250484), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).