C11H13N2O4S- — CID 9125102
5-cyclopropyl-1-[(3R)-1,1-dioxothiolan-3-yl]pyrazole-3-carboxylate (PubChem CID 9125102) has the molecular formula C11H13N2O4S- and a molecular weight of 269.30 g/mol. Its IUPAC name is 5-cyclopropyl-1-[(3R)-1,1-dioxothiolan-3-yl]pyrazole-3-carboxylate.
| Compound Name | 5-cyclopropyl-1-[(3R)-1,1-dioxothiolan-3-yl]pyrazole-3-carboxylate |
|---|---|
| PubChem CID | 9125102 |
| Molecular Formula | C11H13N2O4S- |
| Molecular Weight | 269.30 g/mol |
| Exact Mass | 269.06 |
| IUPAC Name | 5-cyclopropyl-1-[(3R)-1,1-dioxothiolan-3-yl]pyrazole-3-carboxylate |
| SMILES | O=C([O-])c1cc(C2CC2)n([C@@H]2CCS(=O)(=O)C2)n1 |
| InChI | InChI=1S/C11H14N2O4S/c14-11(15)9-5-10(7-1-2-7)13(12-9)8-3-4-18(16,17)6-8/h5,7-8H,1-4,6H2,(H,14,15)/p-1/t8-/m1/s1 |
| InChIKey | JZSBHNJDGWISEK-MRVPVSSYSA-M |
| XLogP | -0.52 |
| TPSA | 92.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.30 |
| LogP ≤ 5 | -0.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |