C23H44 — CID 91251322
(3R,5S)-1,2,3,4,5-pentamethylcyclopentene;(5S)-1,2,3,4,5-pentamethylcyclopentene;propane (PubChem CID 91251322) has the molecular formula C23H44 and a molecular weight of 320.61 g/mol. Its IUPAC name is (3R,5S)-1,2,3,4,5-pentamethylcyclopentene;(5S)-1,2,3,4,5-pentamethylcyclopentene;propane.
| Compound Name | (3R,5S)-1,2,3,4,5-pentamethylcyclopentene;(5S)-1,2,3,4,5-pentamethylcyclopentene;propane |
|---|---|
| PubChem CID | 91251322 |
| Molecular Formula | C23H44 |
| Molecular Weight | 320.61 g/mol |
| Exact Mass | 320.34 |
| IUPAC Name | (3R,5S)-1,2,3,4,5-pentamethylcyclopentene;(5S)-1,2,3,4,5-pentamethylcyclopentene;propane |
| SMILES | CC1=C(C)[C@@H](C)C(C)C1C.CC1=C(C)[C@H](C)C(C)[C@@H]1C.CCC |
| InChI | InChI=1S/2C10H18.C3H8/c2*1-6-7(2)9(4)10(5)8(6)3;1-3-2/h2*6-8H,1-5H3;3H2,1-2H3/t6?,7-,8?;6?,7-,8+;/m0../s1 |
| InChIKey | QRROHBMBMXNIFF-PHKNBCOZSA-N |
| XLogP | 7.91 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.61 |
| LogP ≤ 5 | 7.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|