C42H70O12 — CID 91251331
[8-acetyloxy-7-(1-ethoxyethoxy)-12-[7-[3-[3-(1-ethoxyethoxy)pentan-2-yl]oxiran-2-yl]-6-methylhepta-2,4-dien-2-yl]-7,11-dimethyl-2-oxo-1-oxacyclododec-9-en-4-yl] 2-ethoxyacetate (PubChem CID 91251331) has the molecular formula C42H70O12 and a molecular weight of 767.01 g/mol. Its IUPAC name is [8-acetyloxy-7-(1-ethoxyethoxy)-12-[7-[3-[3-(1-ethoxyethoxy)pentan-2-yl]oxiran-2-yl]-6-methylhepta-2,4-dien-2-yl]-7,11-dimethyl-2-oxo-1-oxacyclododec-9-en-4-yl] 2-ethoxyacetate.
| Compound Name | [8-acetyloxy-7-(1-ethoxyethoxy)-12-[7-[3-[3-(1-ethoxyethoxy)pentan-2-yl]oxiran-2-yl]-6-methylhepta-2,4-dien-2-yl]-7,11-dimethyl-2-oxo-1-oxacyclododec-9-en-4-yl] 2-ethoxyacetate |
|---|---|
| PubChem CID | 91251331 |
| Molecular Formula | C42H70O12 |
| Molecular Weight | 767.01 g/mol |
| Exact Mass | 766.49 |
| IUPAC Name | [8-acetyloxy-7-(1-ethoxyethoxy)-12-[7-[3-[3-(1-ethoxyethoxy)pentan-2-yl]oxiran-2-yl]-6-methylhepta-2,4-dien-2-yl]-7,11-dimethyl-2-oxo-1-oxacyclododec-9-en-4-yl] 2-ethoxyacetate |
| SMILES | CCOCC(=O)OC1CCC(C)(OC(C)OCC)C(OC(C)=O)C=CC(C)C(C(C)=CC=CC(C)CC2OC2C(C)C(CC)OC(C)OCC)OC(=O)C1 |
| InChI | InChI=1S/C42H70O12/c1-13-35(50-32(10)47-15-3)30(8)41-36(52-41)24-27(5)18-17-19-28(6)40-29(7)20-21-37(49-31(9)43)42(12,54-33(11)48-16-4)23-22-34(25-38(44)53-40)51-39(45)26-46-14-2/h17-21,27,29-30,32-37,40-41H,13-16,22-26H2,1-12H3 |
| InChIKey | XKEYRNJYAVYLNN-UHFFFAOYSA-N |
| XLogP | 7.42 |
| TPSA | 137.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 54 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 767.01 |
| LogP ≤ 5 | 7.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|