About ethane;3-methyl-4-methylidene-1,3-oxazinane
ethane;3-methyl-4-methylidene-1,3-oxazinane (PubChem CID 91251354) has the molecular formula C8H17NO
and a molecular weight of 143.23 g/mol. Its IUPAC name is ethane;3-methyl-4-methylidene-1,3-oxazinane.
Molecular Properties
| Compound Name | ethane;3-methyl-4-methylidene-1,3-oxazinane |
| PubChem CID | 91251354 |
| Molecular Formula | C8H17NO |
| Molecular Weight | 143.23 g/mol |
| Exact Mass | 143.13 |
| IUPAC Name | ethane;3-methyl-4-methylidene-1,3-oxazinane |
| SMILES | C=C1CCOCN1C.CC |
| InChI | InChI=1S/C6H11NO.C2H6/c1-6-3-4-8-5-7(6)2;1-2/h1,3-5H2,2H3;1-2H3 |
| InChIKey | LKQNECIUGSLGSH-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 143.23 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze ethane;3-methyl-4-methylidene-1,3-oxazinane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;3-methyl-4-methylidene-1,3-oxazinane?
The IUPAC name of ethane;3-methyl-4-methylidene-1,3-oxazinane (CID 91251354) is ethane;3-methyl-4-methylidene-1,3-oxazinane.
What is the SMILES notation for ethane;3-methyl-4-methylidene-1,3-oxazinane?
The canonical SMILES for ethane;3-methyl-4-methylidene-1,3-oxazinane is C=C1CCOCN1C.CC.
What is the InChIKey of ethane;3-methyl-4-methylidene-1,3-oxazinane?
The InChIKey is LKQNECIUGSLGSH-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H11NO.C2H6/c1-6-3-4-8-5-7(6)2;1-2/h1,3-5H2,2H3;1-2H3.
What are the key properties of ethane;3-methyl-4-methylidene-1,3-oxazinane?
ethane;3-methyl-4-methylidene-1,3-oxazinane has a molecular weight of 143.23 g/mol, XLogP of 1.84, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;3-methyl-4-methylidene-1,3-oxazinane is sourced from PubChem (CID 91251354), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).