C18H21F6NO5S — CID 91251514
(1,3-dihydroxy-4,5,6,7-tetrahydroisoindol-2-yl) 3-(2-bicyclo[2.2.1]heptanyl)-1,1,2,2,3,3-hexafluoropropane-1-sulfonate (PubChem CID 91251514) has the molecular formula C18H21F6NO5S and a molecular weight of 477.42 g/mol. Its IUPAC name is (1,3-dihydroxy-4,5,6,7-tetrahydroisoindol-2-yl) 3-(2-bicyclo[2.2.1]heptanyl)-1,1,2,2,3,3-hexafluoropropane-1-sulfonate.
| Compound Name | (1,3-dihydroxy-4,5,6,7-tetrahydroisoindol-2-yl) 3-(2-bicyclo[2.2.1]heptanyl)-1,1,2,2,3,3-hexafluoropropane-1-sulfonate |
|---|---|
| PubChem CID | 91251514 |
| Molecular Formula | C18H21F6NO5S |
| Molecular Weight | 477.42 g/mol |
| Exact Mass | 477.10 |
| IUPAC Name | (1,3-dihydroxy-4,5,6,7-tetrahydroisoindol-2-yl) 3-(2-bicyclo[2.2.1]heptanyl)-1,1,2,2,3,3-hexafluoropropane-1-sulfonate |
| SMILES | O=S(=O)(On1c(O)c2c(c1O)CCCC2)C(F)(F)C(F)(F)C(F)(F)C1CC2CCC1C2 |
| InChI | InChI=1S/C18H21F6NO5S/c19-16(20,13-8-9-5-6-10(13)7-9)17(21,22)18(23,24)31(28,29)30-25-14(26)11-3-1-2-4-12(11)15(25)27/h9-10,13,26-27H,1-8H2 |
| InChIKey | ZOGWLQORJYQNDE-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 88.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.42 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|