C22H22N4OS — CID 91251521
N-[1-cyano-1-(3,5-dimethylphenyl)-3,3-dimethylbut-1-en-2-yl]-1,2,3-benzothiadiazole-7-carboxamide (PubChem CID 91251521) has the molecular formula C22H22N4OS and a molecular weight of 390.51 g/mol. Its IUPAC name is N-[1-cyano-1-(3,5-dimethylphenyl)-3,3-dimethylbut-1-en-2-yl]-1,2,3-benzothiadiazole-7-carboxamide.
| Compound Name | N-[1-cyano-1-(3,5-dimethylphenyl)-3,3-dimethylbut-1-en-2-yl]-1,2,3-benzothiadiazole-7-carboxamide |
|---|---|
| PubChem CID | 91251521 |
| Molecular Formula | C22H22N4OS |
| Molecular Weight | 390.51 g/mol |
| Exact Mass | 390.15 |
| IUPAC Name | N-[1-cyano-1-(3,5-dimethylphenyl)-3,3-dimethylbut-1-en-2-yl]-1,2,3-benzothiadiazole-7-carboxamide |
| SMILES | Cc1cc(C)cc(C(C#N)=C(NC(=O)c2cccc3nnsc23)C(C)(C)C)c1 |
| InChI | InChI=1S/C22H22N4OS/c1-13-9-14(2)11-15(10-13)17(12-23)20(22(3,4)5)24-21(27)16-7-6-8-18-19(16)28-26-25-18/h6-11H,1-5H3,(H,24,27) |
| InChIKey | AQKCOHAYDUPTMW-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 78.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.51 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|