About ethane;N-methyl-N-(2-methyl-4,5,6,7-tetrahydroindazol-3-yl)acetamide
ethane;N-methyl-N-(2-methyl-4,5,6,7-tetrahydroindazol-3-yl)acetamide (PubChem CID 91251822) has the molecular formula C13H23N3O
and a molecular weight of 237.35 g/mol. Its IUPAC name is ethane;N-methyl-N-(2-methyl-4,5,6,7-tetrahydroindazol-3-yl)acetamide.
Molecular Properties
| Compound Name | ethane;N-methyl-N-(2-methyl-4,5,6,7-tetrahydroindazol-3-yl)acetamide |
| PubChem CID | 91251822 |
| Molecular Formula | C13H23N3O |
| Molecular Weight | 237.35 g/mol |
| Exact Mass | 237.18 |
| IUPAC Name | ethane;N-methyl-N-(2-methyl-4,5,6,7-tetrahydroindazol-3-yl)acetamide |
| SMILES | CC.CC(=O)N(C)c1c2c(nn1C)CCCC2 |
| InChI | InChI=1S/C11H17N3O.C2H6/c1-8(15)13(2)11-9-6-4-5-7-10(9)12-14(11)3;1-2/h4-7H2,1-3H3;1-2H3 |
| InChIKey | MJMXIBNPTSUUMQ-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 38.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 237.35 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze ethane;N-methyl-N-(2-methyl-4,5,6,7-tetrahydroindazol-3-yl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;N-methyl-N-(2-methyl-4,5,6,7-tetrahydroindazol-3-yl)acetamide?
The IUPAC name of ethane;N-methyl-N-(2-methyl-4,5,6,7-tetrahydroindazol-3-yl)acetamide (CID 91251822) is ethane;N-methyl-N-(2-methyl-4,5,6,7-tetrahydroindazol-3-yl)acetamide.
What is the SMILES notation for ethane;N-methyl-N-(2-methyl-4,5,6,7-tetrahydroindazol-3-yl)acetamide?
The canonical SMILES for ethane;N-methyl-N-(2-methyl-4,5,6,7-tetrahydroindazol-3-yl)acetamide is CC.CC(=O)N(C)c1c2c(nn1C)CCCC2.
What is the InChIKey of ethane;N-methyl-N-(2-methyl-4,5,6,7-tetrahydroindazol-3-yl)acetamide?
The InChIKey is MJMXIBNPTSUUMQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H17N3O.C2H6/c1-8(15)13(2)11-9-6-4-5-7-10(9)12-14(11)3;1-2/h4-7H2,1-3H3;1-2H3.
What are the key properties of ethane;N-methyl-N-(2-methyl-4,5,6,7-tetrahydroindazol-3-yl)acetamide?
ethane;N-methyl-N-(2-methyl-4,5,6,7-tetrahydroindazol-3-yl)acetamide has a molecular weight of 237.35 g/mol, XLogP of 2.31, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;N-methyl-N-(2-methyl-4,5,6,7-tetrahydroindazol-3-yl)acetamide is sourced from PubChem (CID 91251822), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).