C25H23F3N2O2 — CID 91252713
5-[(benzylamino)methyl]-7-methyl-2-[[4-(trifluoromethoxy)phenyl]methyl]isoindol-1-ol (PubChem CID 91252713) has the molecular formula C25H23F3N2O2 and a molecular weight of 440.47 g/mol. Its IUPAC name is 5-[(benzylamino)methyl]-7-methyl-2-[[4-(trifluoromethoxy)phenyl]methyl]isoindol-1-ol.
| Compound Name | 5-[(benzylamino)methyl]-7-methyl-2-[[4-(trifluoromethoxy)phenyl]methyl]isoindol-1-ol |
|---|---|
| PubChem CID | 91252713 |
| Molecular Formula | C25H23F3N2O2 |
| Molecular Weight | 440.47 g/mol |
| Exact Mass | 440.17 |
| IUPAC Name | 5-[(benzylamino)methyl]-7-methyl-2-[[4-(trifluoromethoxy)phenyl]methyl]isoindol-1-ol |
| SMILES | Cc1cc(CNCc2ccccc2)cc2cn(Cc3ccc(OC(F)(F)F)cc3)c(O)c12 |
| InChI | InChI=1S/C25H23F3N2O2/c1-17-11-20(14-29-13-18-5-3-2-4-6-18)12-21-16-30(24(31)23(17)21)15-19-7-9-22(10-8-19)32-25(26,27)28/h2-12,16,29,31H,13-15H2,1H3 |
| InChIKey | LRZABBCHPWHGFC-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 46.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.47 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |