C6H8N2S2 — CID 91253009
2-N,3-N-dimethyl-1,4-dithiine-2,3-diimine (PubChem CID 91253009) has the molecular formula C6H8N2S2 and a molecular weight of 172.28 g/mol. Its IUPAC name is 2-N,3-N-dimethyl-1,4-dithiine-2,3-diimine.
| Compound Name | 2-N,3-N-dimethyl-1,4-dithiine-2,3-diimine |
|---|---|
| PubChem CID | 91253009 |
| Molecular Formula | C6H8N2S2 |
| Molecular Weight | 172.28 g/mol |
| Exact Mass | 172.01 |
| IUPAC Name | 2-N,3-N-dimethyl-1,4-dithiine-2,3-diimine |
| SMILES | C/N=c1\sccs\c1=N/C |
| InChI | InChI=1S/C6H8N2S2/c1-7-5-6(8-2)10-4-3-9-5/h3-4H,1-2H3/b7-5-,8-6- |
| InChIKey | GZOALLXECPZYDH-SFECMWDFSA-N |
| XLogP | 0.87 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.28 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |