About 2-N,3-N-dimethyl-1,4-dithiine-2,3-diimine
2-N,3-N-dimethyl-1,4-dithiine-2,3-diimine (PubChem CID 91253009) has the molecular formula C6H8N2S2
and a molecular weight of 172.28 g/mol. Its IUPAC name is 2-N,3-N-dimethyl-1,4-dithiine-2,3-diimine.
Molecular Properties
| Compound Name | 2-N,3-N-dimethyl-1,4-dithiine-2,3-diimine |
| PubChem CID | 91253009 |
| Molecular Formula | C6H8N2S2 |
| Molecular Weight | 172.28 g/mol |
| Exact Mass | 172.01 |
| IUPAC Name | 2-N,3-N-dimethyl-1,4-dithiine-2,3-diimine |
| SMILES | C/N=c1\sccs\c1=N/C |
| InChI | InChI=1S/C6H8N2S2/c1-7-5-6(8-2)10-4-3-9-5/h3-4H,1-2H3/b7-5-,8-6- |
| InChIKey | GZOALLXECPZYDH-SFECMWDFSA-N |
| XLogP | 0.87 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.28 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-N,3-N-dimethyl-1,4-dithiine-2,3-diimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-N,3-N-dimethyl-1,4-dithiine-2,3-diimine?
The IUPAC name of 2-N,3-N-dimethyl-1,4-dithiine-2,3-diimine (CID 91253009) is 2-N,3-N-dimethyl-1,4-dithiine-2,3-diimine.
What is the SMILES notation for 2-N,3-N-dimethyl-1,4-dithiine-2,3-diimine?
The canonical SMILES for 2-N,3-N-dimethyl-1,4-dithiine-2,3-diimine is C/N=c1\sccs\c1=N/C.
What is the InChIKey of 2-N,3-N-dimethyl-1,4-dithiine-2,3-diimine?
The InChIKey is GZOALLXECPZYDH-SFECMWDFSA-N. The full InChI is InChI=1S/C6H8N2S2/c1-7-5-6(8-2)10-4-3-9-5/h3-4H,1-2H3/b7-5-,8-6-.
What are the key properties of 2-N,3-N-dimethyl-1,4-dithiine-2,3-diimine?
2-N,3-N-dimethyl-1,4-dithiine-2,3-diimine has a molecular weight of 172.28 g/mol, XLogP of 0.87, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-N,3-N-dimethyl-1,4-dithiine-2,3-diimine is sourced from PubChem (CID 91253009), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).