C36H60N8O4 — CID 91253252
2-N,2-N,4-N-tris(1-hydroxy-2,2,6,6-tetramethylpiperidin-4-yl)-6-phenoxy-1,3,5-triazine-2,4-diamine (PubChem CID 91253252) has the molecular formula C36H60N8O4 and a molecular weight of 668.93 g/mol. Its IUPAC name is 2-N,2-N,4-N-tris(1-hydroxy-2,2,6,6-tetramethylpiperidin-4-yl)-6-phenoxy-1,3,5-triazine-2,4-diamine.
| Compound Name | 2-N,2-N,4-N-tris(1-hydroxy-2,2,6,6-tetramethylpiperidin-4-yl)-6-phenoxy-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 91253252 |
| Molecular Formula | C36H60N8O4 |
| Molecular Weight | 668.93 g/mol |
| Exact Mass | 668.47 |
| IUPAC Name | 2-N,2-N,4-N-tris(1-hydroxy-2,2,6,6-tetramethylpiperidin-4-yl)-6-phenoxy-1,3,5-triazine-2,4-diamine |
| SMILES | CC1(C)CC(Nc2nc(Oc3ccccc3)nc(N(C3CC(C)(C)N(O)C(C)(C)C3)C3CC(C)(C)N(O)C(C)(C)C3)n2)CC(C)(C)N1O |
| InChI | InChI=1S/C36H60N8O4/c1-31(2)18-24(19-32(3,4)42(31)45)37-28-38-29(40-30(39-28)48-27-16-14-13-15-17-27)41(25-20-33(5,6)43(46)34(7,8)21-25)26-22-35(9,10)44(47)36(11,12)23-26/h13-17,24-26,45-47H,18-23H2,1-12H3,(H,37,38,39,40) |
| InChIKey | UAVVOAIPZOQCNO-UHFFFAOYSA-N |
| XLogP | 7.11 |
| TPSA | 133.58 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 48 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 668.93 |
| LogP ≤ 5 | 7.11 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |