C21H29NO3 — CID 91253258
1-[(9R,10R,13S,14S)-17-amino-3-hydroxy-10,13-dimethyl-4,9,11,12,14,15,16,17-octahydro-3H-cyclopenta[a]phenanthren-1-yl]-2-hydroxyethanone (PubChem CID 91253258) has the molecular formula C21H29NO3 and a molecular weight of 343.47 g/mol. Its IUPAC name is 1-[(9R,10R,13S,14S)-17-amino-3-hydroxy-10,13-dimethyl-4,9,11,12,14,15,16,17-octahydro-3H-cyclopenta[a]phenanthren-1-yl]-2-hydroxyethanone.
| Compound Name | 1-[(9R,10R,13S,14S)-17-amino-3-hydroxy-10,13-dimethyl-4,9,11,12,14,15,16,17-octahydro-3H-cyclopenta[a]phenanthren-1-yl]-2-hydroxyethanone |
|---|---|
| PubChem CID | 91253258 |
| Molecular Formula | C21H29NO3 |
| Molecular Weight | 343.47 g/mol |
| Exact Mass | 343.21 |
| IUPAC Name | 1-[(9R,10R,13S,14S)-17-amino-3-hydroxy-10,13-dimethyl-4,9,11,12,14,15,16,17-octahydro-3H-cyclopenta[a]phenanthren-1-yl]-2-hydroxyethanone |
| SMILES | C[C@]12C(=CC=C3[C@H]1CC[C@]1(C)C(N)CC[C@@H]31)CC(O)C=C2C(=O)CO |
| InChI | InChI=1S/C21H29NO3/c1-20-8-7-16-14(15(20)5-6-19(20)22)4-3-12-9-13(24)10-17(18(25)11-23)21(12,16)2/h3-4,10,13,15-16,19,23-24H,5-9,11,22H2,1-2H3/t13?,15-,16+,19?,20-,21-/m0/s1 |
| InChIKey | XWNGCFXISJQWSJ-ATOLSCLRSA-N |
| XLogP | 2.27 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.47 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |