C17H20N2O2 — CID 91253361
1-acetyl-4-phenyl-5a,6,7,8,9,9a-hexahydro-3H-1,5-benzodiazepin-2-one (PubChem CID 91253361) has the molecular formula C17H20N2O2 and a molecular weight of 284.36 g/mol. Its IUPAC name is 1-acetyl-4-phenyl-5a,6,7,8,9,9a-hexahydro-3H-1,5-benzodiazepin-2-one.
| Compound Name | 1-acetyl-4-phenyl-5a,6,7,8,9,9a-hexahydro-3H-1,5-benzodiazepin-2-one |
|---|---|
| PubChem CID | 91253361 |
| Molecular Formula | C17H20N2O2 |
| Molecular Weight | 284.36 g/mol |
| Exact Mass | 284.15 |
| IUPAC Name | 1-acetyl-4-phenyl-5a,6,7,8,9,9a-hexahydro-3H-1,5-benzodiazepin-2-one |
| SMILES | CC(=O)N1C(=O)CC(c2ccccc2)=NC2CCCCC21 |
| InChI | InChI=1S/C17H20N2O2/c1-12(20)19-16-10-6-5-9-14(16)18-15(11-17(19)21)13-7-3-2-4-8-13/h2-4,7-8,14,16H,5-6,9-11H2,1H3 |
| InChIKey | YIAUMTDOFNVCCF-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 49.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.36 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |