C28H25F3N2O5S — CID 91253598
2-[(3-prop-2-enylbenzoyl)amino]-4-[1-(2,4,5-trifluoro-3-methoxybenzoyl)piperidin-3-yl]thiophene-3-carboxylic acid (PubChem CID 91253598) has the molecular formula C28H25F3N2O5S and a molecular weight of 558.58 g/mol. Its IUPAC name is 2-[(3-prop-2-enylbenzoyl)amino]-4-[1-(2,4,5-trifluoro-3-methoxybenzoyl)piperidin-3-yl]thiophene-3-carboxylic acid.
| Compound Name | 2-[(3-prop-2-enylbenzoyl)amino]-4-[1-(2,4,5-trifluoro-3-methoxybenzoyl)piperidin-3-yl]thiophene-3-carboxylic acid |
|---|---|
| PubChem CID | 91253598 |
| Molecular Formula | C28H25F3N2O5S |
| Molecular Weight | 558.58 g/mol |
| Exact Mass | 558.14 |
| IUPAC Name | 2-[(3-prop-2-enylbenzoyl)amino]-4-[1-(2,4,5-trifluoro-3-methoxybenzoyl)piperidin-3-yl]thiophene-3-carboxylic acid |
| SMILES | C=CCc1cccc(C(=O)Nc2scc(C3CCCN(C(=O)c4cc(F)c(F)c(OC)c4F)C3)c2C(=O)O)c1 |
| InChI | InChI=1S/C28H25F3N2O5S/c1-3-6-15-7-4-8-16(11-15)25(34)32-26-21(28(36)37)19(14-39-26)17-9-5-10-33(13-17)27(35)18-12-20(29)23(31)24(38-2)22(18)30/h3-4,7-8,11-12,14,17H,1,5-6,9-10,13H2,2H3,(H,32,34)(H,36,37) |
| InChIKey | YYGQDHNAYHMOLY-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.58 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|