C24H41O7P — CID 91253614
(4R)-4-[(3R,5R,8R,9S,10S,12S,13R,14S,17R)-3,12-dihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]-2-phosphonopentanoic acid (PubChem CID 91253614) has the molecular formula C24H41O7P and a molecular weight of 472.56 g/mol. Its IUPAC name is (4R)-4-[(3R,5R,8R,9S,10S,12S,13R,14S,17R)-3,12-dihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]-2-phosphonopentanoic acid.
| Compound Name | (4R)-4-[(3R,5R,8R,9S,10S,12S,13R,14S,17R)-3,12-dihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]-2-phosphonopentanoic acid |
|---|---|
| PubChem CID | 91253614 |
| Molecular Formula | C24H41O7P |
| Molecular Weight | 472.56 g/mol |
| Exact Mass | 472.26 |
| IUPAC Name | (4R)-4-[(3R,5R,8R,9S,10S,12S,13R,14S,17R)-3,12-dihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]-2-phosphonopentanoic acid |
| SMILES | C[C@H](CC(C(=O)O)P(=O)(O)O)[C@H]1CC[C@H]2[C@@H]3CC[C@@H]4C[C@H](O)CC[C@]4(C)[C@H]3C[C@H](O)[C@]12C |
| InChI | InChI=1S/C24H41O7P/c1-13(10-20(22(27)28)32(29,30)31)17-6-7-18-16-5-4-14-11-15(25)8-9-23(14,2)19(16)12-21(26)24(17,18)3/h13-21,25-26H,4-12H2,1-3H3,(H,27,28)(H2,29,30,31)/t13-,14-,15-,16+,17-,18+,19+,20?,21+,23+,24-/m1/s1 |
| InChIKey | NVZCYRMNNKLEKK-UTNCPAPFSA-N |
| XLogP | 3.63 |
| TPSA | 135.29 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.56 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|