About 5-methyl-N-prop-2-ynyl-1,3-thiazol-2-amine
5-methyl-N-prop-2-ynyl-1,3-thiazol-2-amine (PubChem CID 91253883) has the molecular formula C7H8N2S
and a molecular weight of 152.22 g/mol. Its IUPAC name is 5-methyl-N-prop-2-ynyl-1,3-thiazol-2-amine.
Molecular Properties
| Compound Name | 5-methyl-N-prop-2-ynyl-1,3-thiazol-2-amine |
| PubChem CID | 91253883 |
| Molecular Formula | C7H8N2S |
| Molecular Weight | 152.22 g/mol |
| Exact Mass | 152.04 |
| IUPAC Name | 5-methyl-N-prop-2-ynyl-1,3-thiazol-2-amine |
| SMILES | C#CCNc1ncc(C)s1 |
| InChI | InChI=1S/C7H8N2S/c1-3-4-8-7-9-5-6(2)10-7/h1,5H,4H2,2H3,(H,8,9) |
| InChIKey | KZYQXURXLWGHIO-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 152.22 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 5-methyl-N-prop-2-ynyl-1,3-thiazol-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methyl-N-prop-2-ynyl-1,3-thiazol-2-amine?
The IUPAC name of 5-methyl-N-prop-2-ynyl-1,3-thiazol-2-amine (CID 91253883) is 5-methyl-N-prop-2-ynyl-1,3-thiazol-2-amine.
What is the SMILES notation for 5-methyl-N-prop-2-ynyl-1,3-thiazol-2-amine?
The canonical SMILES for 5-methyl-N-prop-2-ynyl-1,3-thiazol-2-amine is C#CCNc1ncc(C)s1.
What is the InChIKey of 5-methyl-N-prop-2-ynyl-1,3-thiazol-2-amine?
The InChIKey is KZYQXURXLWGHIO-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8N2S/c1-3-4-8-7-9-5-6(2)10-7/h1,5H,4H2,2H3,(H,8,9).
What are the key properties of 5-methyl-N-prop-2-ynyl-1,3-thiazol-2-amine?
5-methyl-N-prop-2-ynyl-1,3-thiazol-2-amine has a molecular weight of 152.22 g/mol, XLogP of 1.50, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methyl-N-prop-2-ynyl-1,3-thiazol-2-amine is sourced from PubChem (CID 91253883), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).