C26H18ClF8N7O — CID 91253954
2-N-[(6-chloro-3-pyridinyl)methyl]-4-N-[4-fluoro-3-(trifluoromethyl)phenyl]-6-[[4-(1,1,2,2-tetrafluoroethoxy)phenyl]methyldiazenyl]pyrimidine-2,4-diamine (PubChem CID 91253954) has the molecular formula C26H18ClF8N7O and a molecular weight of 631.92 g/mol. Its IUPAC name is 2-N-[(6-chloro-3-pyridinyl)methyl]-4-N-[4-fluoro-3-(trifluoromethyl)phenyl]-6-[[4-(1,1,2,2-tetrafluoroethoxy)phenyl]methyldiazenyl]pyrimidine-2,4-diamine.
| Compound Name | 2-N-[(6-chloro-3-pyridinyl)methyl]-4-N-[4-fluoro-3-(trifluoromethyl)phenyl]-6-[[4-(1,1,2,2-tetrafluoroethoxy)phenyl]methyldiazenyl]pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 91253954 |
| Molecular Formula | C26H18ClF8N7O |
| Molecular Weight | 631.92 g/mol |
| Exact Mass | 631.11 |
| IUPAC Name | 2-N-[(6-chloro-3-pyridinyl)methyl]-4-N-[4-fluoro-3-(trifluoromethyl)phenyl]-6-[[4-(1,1,2,2-tetrafluoroethoxy)phenyl]methyldiazenyl]pyrimidine-2,4-diamine |
| SMILES | Fc1ccc(Nc2cc(/N=N/Cc3ccc(OC(F)(F)C(F)F)cc3)nc(NCc3ccc(Cl)nc3)n2)cc1C(F)(F)F |
| InChI | InChI=1S/C26H18ClF8N7O/c27-20-8-3-15(11-36-20)12-37-24-40-21(39-16-4-7-19(28)18(9-16)25(31,32)33)10-22(41-24)42-38-13-14-1-5-17(6-2-14)43-26(34,35)23(29)30/h1-11,23H,12-13H2,(H2,37,39,40,41)/b42-38+ |
| InChIKey | SEHSIOHOFGPVNG-WUHPQKATSA-N |
| XLogP | 8.56 |
| TPSA | 96.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 631.92 |
| LogP ≤ 5 | 8.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|