C47H58N4O3 — CID 91254276
3-(4-tert-butylphenyl)-N-[1-(2-hydroxyethyl)indol-6-yl]propanamide;3-(4-tert-butylphenyl)-N-(1-propylindol-5-yl)propanamide (PubChem CID 91254276) has the molecular formula C47H58N4O3 and a molecular weight of 727.01 g/mol. Its IUPAC name is 3-(4-tert-butylphenyl)-N-[1-(2-hydroxyethyl)indol-6-yl]propanamide;3-(4-tert-butylphenyl)-N-(1-propylindol-5-yl)propanamide.
| Compound Name | 3-(4-tert-butylphenyl)-N-[1-(2-hydroxyethyl)indol-6-yl]propanamide;3-(4-tert-butylphenyl)-N-(1-propylindol-5-yl)propanamide |
|---|---|
| PubChem CID | 91254276 |
| Molecular Formula | C47H58N4O3 |
| Molecular Weight | 727.01 g/mol |
| Exact Mass | 726.45 |
| IUPAC Name | 3-(4-tert-butylphenyl)-N-[1-(2-hydroxyethyl)indol-6-yl]propanamide;3-(4-tert-butylphenyl)-N-(1-propylindol-5-yl)propanamide |
| SMILES | CC(C)(C)c1ccc(CCC(=O)Nc2ccc3ccn(CCO)c3c2)cc1.CCCn1ccc2cc(NC(=O)CCc3ccc(C(C)(C)C)cc3)ccc21 |
| InChI | InChI=1S/C24H30N2O.C23H28N2O2/c1-5-15-26-16-14-19-17-21(11-12-22(19)26)25-23(27)13-8-18-6-9-20(10-7-18)24(2,3)4;1-23(2,3)19-8-4-17(5-9-19)6-11-22(27)24-20-10-7-18-12-13-25(14-15-26)21(18)16-20/h6-7,9-12,14,16-17H,5,8,13,15H2,1-4H3,(H,25,27);4-5,7-10,12-13,16,26H,6,11,14-15H2,1-3H3,(H,24,27) |
| InChIKey | BJYJUHVHFYGLKS-UHFFFAOYSA-N |
| XLogP | 10.42 |
| TPSA | 88.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 727.01 |
| LogP ≤ 5 | 10.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |