C18H17Cl2NO4 — CID 9125437
[2-[benzyl(methyl)amino]-2-oxoethyl] 3,5-dichloro-4-methoxybenzoate (PubChem CID 9125437) has the molecular formula C18H17Cl2NO4 and a molecular weight of 382.24 g/mol. Its IUPAC name is [2-[benzyl(methyl)amino]-2-oxoethyl] 3,5-dichloro-4-methoxybenzoate.
| Compound Name | [2-[benzyl(methyl)amino]-2-oxoethyl] 3,5-dichloro-4-methoxybenzoate |
|---|---|
| PubChem CID | 9125437 |
| Molecular Formula | C18H17Cl2NO4 |
| Molecular Weight | 382.24 g/mol |
| Exact Mass | 381.05 |
| IUPAC Name | [2-[benzyl(methyl)amino]-2-oxoethyl] 3,5-dichloro-4-methoxybenzoate |
| SMILES | COc1c(Cl)cc(C(=O)OCC(=O)N(C)Cc2ccccc2)cc1Cl |
| InChI | InChI=1S/C18H17Cl2NO4/c1-21(10-12-6-4-3-5-7-12)16(22)11-25-18(23)13-8-14(19)17(24-2)15(20)9-13/h3-9H,10-11H2,1-2H3 |
| InChIKey | PLLOBDHUAWPKFB-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.24 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |