About 2-(cyclohexylmethyl)-2H-1,4-oxazine
2-(cyclohexylmethyl)-2H-1,4-oxazine (PubChem CID 91254717) has the molecular formula C11H17NO
and a molecular weight of 179.26 g/mol. Its IUPAC name is 2-(cyclohexylmethyl)-2H-1,4-oxazine.
Molecular Properties
| Compound Name | 2-(cyclohexylmethyl)-2H-1,4-oxazine |
| PubChem CID | 91254717 |
| Molecular Formula | C11H17NO |
| Molecular Weight | 179.26 g/mol |
| Exact Mass | 179.13 |
| IUPAC Name | 2-(cyclohexylmethyl)-2H-1,4-oxazine |
| SMILES | C1=COC(CC2CCCCC2)C=N1 |
| InChI | InChI=1S/C11H17NO/c1-2-4-10(5-3-1)8-11-9-12-6-7-13-11/h6-7,9-11H,1-5,8H2 |
| InChIKey | ZRDHICPDNZBCJJ-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.26 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-(cyclohexylmethyl)-2H-1,4-oxazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(cyclohexylmethyl)-2H-1,4-oxazine?
The IUPAC name of 2-(cyclohexylmethyl)-2H-1,4-oxazine (CID 91254717) is 2-(cyclohexylmethyl)-2H-1,4-oxazine.
What is the SMILES notation for 2-(cyclohexylmethyl)-2H-1,4-oxazine?
The canonical SMILES for 2-(cyclohexylmethyl)-2H-1,4-oxazine is C1=COC(CC2CCCCC2)C=N1.
What is the InChIKey of 2-(cyclohexylmethyl)-2H-1,4-oxazine?
The InChIKey is ZRDHICPDNZBCJJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H17NO/c1-2-4-10(5-3-1)8-11-9-12-6-7-13-11/h6-7,9-11H,1-5,8H2.
What are the key properties of 2-(cyclohexylmethyl)-2H-1,4-oxazine?
2-(cyclohexylmethyl)-2H-1,4-oxazine has a molecular weight of 179.26 g/mol, XLogP of 2.90, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(cyclohexylmethyl)-2H-1,4-oxazine is sourced from PubChem (CID 91254717), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).