C14H12Cl2N4O2 — CID 91255498
4-(2,3-dichlorophenyl)-6-ethyl-5-nitro-4,5-dihydro-1H-pyrazolo[5,4-b]pyridine (PubChem CID 91255498) has the molecular formula C14H12Cl2N4O2 and a molecular weight of 339.18 g/mol. Its IUPAC name is 4-(2,3-dichlorophenyl)-6-ethyl-5-nitro-4,5-dihydro-1H-pyrazolo[5,4-b]pyridine.
| Compound Name | 4-(2,3-dichlorophenyl)-6-ethyl-5-nitro-4,5-dihydro-1H-pyrazolo[5,4-b]pyridine |
|---|---|
| PubChem CID | 91255498 |
| Molecular Formula | C14H12Cl2N4O2 |
| Molecular Weight | 339.18 g/mol |
| Exact Mass | 338.03 |
| IUPAC Name | 4-(2,3-dichlorophenyl)-6-ethyl-5-nitro-4,5-dihydro-1H-pyrazolo[5,4-b]pyridine |
| SMILES | CCC1=Nc2[nH]ncc2C(c2cccc(Cl)c2Cl)C1[N+](=O)[O-] |
| InChI | InChI=1S/C14H12Cl2N4O2/c1-2-10-13(20(21)22)11(8-6-17-19-14(8)18-10)7-4-3-5-9(15)12(7)16/h3-6,11,13H,2H2,1H3,(H,17,19) |
| InChIKey | DFWSAVPFYJMSKJ-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 84.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.18 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|