C26H30N4O5S — CID 91255747
N-[7-[[6-[(2,4-dimethoxyphenyl)methyl-methylamino]-3-pyridinyl]-hydroxymethyl]-8-oxo-4,5,6,7-tetrahydrocyclohepta[d][1,3]thiazol-2-yl]acetamide (PubChem CID 91255747) has the molecular formula C26H30N4O5S and a molecular weight of 510.62 g/mol. Its IUPAC name is N-[7-[[6-[(2,4-dimethoxyphenyl)methyl-methylamino]-3-pyridinyl]-hydroxymethyl]-8-oxo-4,5,6,7-tetrahydrocyclohepta[d][1,3]thiazol-2-yl]acetamide.
| Compound Name | N-[7-[[6-[(2,4-dimethoxyphenyl)methyl-methylamino]-3-pyridinyl]-hydroxymethyl]-8-oxo-4,5,6,7-tetrahydrocyclohepta[d][1,3]thiazol-2-yl]acetamide |
|---|---|
| PubChem CID | 91255747 |
| Molecular Formula | C26H30N4O5S |
| Molecular Weight | 510.62 g/mol |
| Exact Mass | 510.19 |
| IUPAC Name | N-[7-[[6-[(2,4-dimethoxyphenyl)methyl-methylamino]-3-pyridinyl]-hydroxymethyl]-8-oxo-4,5,6,7-tetrahydrocyclohepta[d][1,3]thiazol-2-yl]acetamide |
| SMILES | COc1ccc(CN(C)c2ccc(C(O)C3CCCc4nc(NC(C)=O)sc4C3=O)cn2)c(OC)c1 |
| InChI | InChI=1S/C26H30N4O5S/c1-15(31)28-26-29-20-7-5-6-19(24(33)25(20)36-26)23(32)16-9-11-22(27-13-16)30(2)14-17-8-10-18(34-3)12-21(17)35-4/h8-13,19,23,32H,5-7,14H2,1-4H3,(H,28,29,31) |
| InChIKey | UNJOYURMYSGECB-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 113.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.62 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |