C16H17NO — CID 91255786
(3-methylphenyl)-(1,3,4,5-tetrahydroisoindol-2-yl)methanone (PubChem CID 91255786) has the molecular formula C16H17NO and a molecular weight of 239.32 g/mol. Its IUPAC name is (3-methylphenyl)-(1,3,4,5-tetrahydroisoindol-2-yl)methanone.
| Compound Name | (3-methylphenyl)-(1,3,4,5-tetrahydroisoindol-2-yl)methanone |
|---|---|
| PubChem CID | 91255786 |
| Molecular Formula | C16H17NO |
| Molecular Weight | 239.32 g/mol |
| Exact Mass | 239.13 |
| IUPAC Name | (3-methylphenyl)-(1,3,4,5-tetrahydroisoindol-2-yl)methanone |
| SMILES | Cc1cccc(C(=O)N2CC3=C(CCC=C3)C2)c1 |
| InChI | InChI=1S/C16H17NO/c1-12-5-4-8-13(9-12)16(18)17-10-14-6-2-3-7-15(14)11-17/h2,4-6,8-9H,3,7,10-11H2,1H3 |
| InChIKey | SKFMOJXQIHPJTH-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.32 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |