About ethane;1-(methylamino)cyclopropane-1-carboxylic acid
ethane;1-(methylamino)cyclopropane-1-carboxylic acid (PubChem CID 91255825) has the molecular formula C7H15NO2
and a molecular weight of 145.20 g/mol. Its IUPAC name is ethane;1-(methylamino)cyclopropane-1-carboxylic acid.
Molecular Properties
| Compound Name | ethane;1-(methylamino)cyclopropane-1-carboxylic acid |
| PubChem CID | 91255825 |
| Molecular Formula | C7H15NO2 |
| Molecular Weight | 145.20 g/mol |
| Exact Mass | 145.11 |
| IUPAC Name | ethane;1-(methylamino)cyclopropane-1-carboxylic acid |
| SMILES | CC.CNC1(C(=O)O)CC1 |
| InChI | InChI=1S/C5H9NO2.C2H6/c1-6-5(2-3-5)4(7)8;1-2/h6H,2-3H2,1H3,(H,7,8);1-2H3 |
| InChIKey | UHYJAVZCOQTMEG-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 145.20 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze ethane;1-(methylamino)cyclopropane-1-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;1-(methylamino)cyclopropane-1-carboxylic acid?
The IUPAC name of ethane;1-(methylamino)cyclopropane-1-carboxylic acid (CID 91255825) is ethane;1-(methylamino)cyclopropane-1-carboxylic acid.
What is the SMILES notation for ethane;1-(methylamino)cyclopropane-1-carboxylic acid?
The canonical SMILES for ethane;1-(methylamino)cyclopropane-1-carboxylic acid is CC.CNC1(C(=O)O)CC1.
What is the InChIKey of ethane;1-(methylamino)cyclopropane-1-carboxylic acid?
The InChIKey is UHYJAVZCOQTMEG-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H9NO2.C2H6/c1-6-5(2-3-5)4(7)8;1-2/h6H,2-3H2,1H3,(H,7,8);1-2H3.
What are the key properties of ethane;1-(methylamino)cyclopropane-1-carboxylic acid?
ethane;1-(methylamino)cyclopropane-1-carboxylic acid has a molecular weight of 145.20 g/mol, XLogP of 0.85, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;1-(methylamino)cyclopropane-1-carboxylic acid is sourced from PubChem (CID 91255825), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).