About 3'-(4-chlorophenyl)spiro[1-azabicyclo[2.2.2]octane-3,5'-2H-1,2-oxazole]
3'-(4-chlorophenyl)spiro[1-azabicyclo[2.2.2]octane-3,5'-2H-1,2-oxazole] (PubChem CID 91256046) has the molecular formula C15H17ClN2O
and a molecular weight of 276.77 g/mol. Its IUPAC name is 3'-(4-chlorophenyl)spiro[1-azabicyclo[2.2.2]octane-3,5'-2H-1,2-oxazole].
Molecular Properties
| Compound Name | 3'-(4-chlorophenyl)spiro[1-azabicyclo[2.2.2]octane-3,5'-2H-1,2-oxazole] |
| PubChem CID | 91256046 |
| Molecular Formula | C15H17ClN2O |
| Molecular Weight | 276.77 g/mol |
| Exact Mass | 276.10 |
| IUPAC Name | 3'-(4-chlorophenyl)spiro[1-azabicyclo[2.2.2]octane-3,5'-2H-1,2-oxazole] |
| SMILES | Clc1ccc(C2=CC3(CN4CCC3CC4)ON2)cc1 |
| InChI | InChI=1S/C15H17ClN2O/c16-13-3-1-11(2-4-13)14-9-15(19-17-14)10-18-7-5-12(15)6-8-18/h1-4,9,12,17H,5-8,10H2 |
| InChIKey | XYAMQDDOOUJXHA-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 276.77 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3'-(4-chlorophenyl)spiro[1-azabicyclo[2.2.2]octane-3,5'-2H-1,2-oxazole] with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3'-(4-chlorophenyl)spiro[1-azabicyclo[2.2.2]octane-3,5'-2H-1,2-oxazole]?
The IUPAC name of 3'-(4-chlorophenyl)spiro[1-azabicyclo[2.2.2]octane-3,5'-2H-1,2-oxazole] (CID 91256046) is 3'-(4-chlorophenyl)spiro[1-azabicyclo[2.2.2]octane-3,5'-2H-1,2-oxazole].
What is the SMILES notation for 3'-(4-chlorophenyl)spiro[1-azabicyclo[2.2.2]octane-3,5'-2H-1,2-oxazole]?
The canonical SMILES for 3'-(4-chlorophenyl)spiro[1-azabicyclo[2.2.2]octane-3,5'-2H-1,2-oxazole] is Clc1ccc(C2=CC3(CN4CCC3CC4)ON2)cc1.
What is the InChIKey of 3'-(4-chlorophenyl)spiro[1-azabicyclo[2.2.2]octane-3,5'-2H-1,2-oxazole]?
The InChIKey is XYAMQDDOOUJXHA-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H17ClN2O/c16-13-3-1-11(2-4-13)14-9-15(19-17-14)10-18-7-5-12(15)6-8-18/h1-4,9,12,17H,5-8,10H2.
What are the key properties of 3'-(4-chlorophenyl)spiro[1-azabicyclo[2.2.2]octane-3,5'-2H-1,2-oxazole]?
3'-(4-chlorophenyl)spiro[1-azabicyclo[2.2.2]octane-3,5'-2H-1,2-oxazole] has a molecular weight of 276.77 g/mol, XLogP of 2.68, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3'-(4-chlorophenyl)spiro[1-azabicyclo[2.2.2]octane-3,5'-2H-1,2-oxazole] is sourced from PubChem (CID 91256046), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).