C28H32N2O6S — CID 91256188
2-[3-[4-[4-[[(2S)-4-methyl-2,3-dihydro-1,4-benzoxazin-2-yl]methoxy]phenyl]sulfonylbutylamino]phenyl]acetic acid (PubChem CID 91256188) has the molecular formula C28H32N2O6S and a molecular weight of 524.64 g/mol. Its IUPAC name is 2-[3-[4-[4-[[(2S)-4-methyl-2,3-dihydro-1,4-benzoxazin-2-yl]methoxy]phenyl]sulfonylbutylamino]phenyl]acetic acid.
| Compound Name | 2-[3-[4-[4-[[(2S)-4-methyl-2,3-dihydro-1,4-benzoxazin-2-yl]methoxy]phenyl]sulfonylbutylamino]phenyl]acetic acid |
|---|---|
| PubChem CID | 91256188 |
| Molecular Formula | C28H32N2O6S |
| Molecular Weight | 524.64 g/mol |
| Exact Mass | 524.20 |
| IUPAC Name | 2-[3-[4-[4-[[(2S)-4-methyl-2,3-dihydro-1,4-benzoxazin-2-yl]methoxy]phenyl]sulfonylbutylamino]phenyl]acetic acid |
| SMILES | CN1C[C@@H](COc2ccc(S(=O)(=O)CCCCNc3cccc(CC(=O)O)c3)cc2)Oc2ccccc21 |
| InChI | InChI=1S/C28H32N2O6S/c1-30-19-24(36-27-10-3-2-9-26(27)30)20-35-23-11-13-25(14-12-23)37(33,34)16-5-4-15-29-22-8-6-7-21(17-22)18-28(31)32/h2-3,6-14,17,24,29H,4-5,15-16,18-20H2,1H3,(H,31,32)/t24-/m0/s1 |
| InChIKey | VCKGJHBWEMGJCF-DEOSSOPVSA-N |
| XLogP | 4.26 |
| TPSA | 105.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.64 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|