C14H15NO3 — CID 91256397
2-(3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinolin-8-yloxy)acetic acid (PubChem CID 91256397) has the molecular formula C14H15NO3 and a molecular weight of 245.28 g/mol. Its IUPAC name is 2-(3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinolin-8-yloxy)acetic acid.
| Compound Name | 2-(3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinolin-8-yloxy)acetic acid |
|---|---|
| PubChem CID | 91256397 |
| Molecular Formula | C14H15NO3 |
| Molecular Weight | 245.28 g/mol |
| Exact Mass | 245.11 |
| IUPAC Name | 2-(3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinolin-8-yloxy)acetic acid |
| SMILES | O=C(O)COc1ccc2c(c1)C1C=CCC1CN2 |
| InChI | InChI=1S/C14H15NO3/c16-14(17)8-18-10-4-5-13-12(6-10)11-3-1-2-9(11)7-15-13/h1,3-6,9,11,15H,2,7-8H2,(H,16,17) |
| InChIKey | BNTYQAVGBVYNSH-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.28 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'anil_alk_ene(51)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|