C50H33O2P2+ — CID 91256515
20-hydroxy-2,12,16,20-tetraphenyl-12λ5-phospha-20-phosphoniaheptacyclo[15.11.0.03,15.05,13.06,11.019,27.021,26]octacosa-1,3,5(13),6,8,10,14,16,18,21,23,25,27-tridecaene 12-oxide (PubChem CID 91256515) has the molecular formula C50H33O2P2+ and a molecular weight of 727.76 g/mol. Its IUPAC name is 20-hydroxy-2,12,16,20-tetraphenyl-12λ5-phospha-20-phosphoniaheptacyclo[15.11.0.03,15.05,13.06,11.019,27.021,26]octacosa-1,3,5(13),6,8,10,14,16,18,21,23,25,27-tridecaene 12-oxide.
| Compound Name | 20-hydroxy-2,12,16,20-tetraphenyl-12λ5-phospha-20-phosphoniaheptacyclo[15.11.0.03,15.05,13.06,11.019,27.021,26]octacosa-1,3,5(13),6,8,10,14,16,18,21,23,25,27-tridecaene 12-oxide |
|---|---|
| PubChem CID | 91256515 |
| Molecular Formula | C50H33O2P2+ |
| Molecular Weight | 727.76 g/mol |
| Exact Mass | 727.20 |
| IUPAC Name | 20-hydroxy-2,12,16,20-tetraphenyl-12λ5-phospha-20-phosphoniaheptacyclo[15.11.0.03,15.05,13.06,11.019,27.021,26]octacosa-1,3,5(13),6,8,10,14,16,18,21,23,25,27-tridecaene 12-oxide |
| SMILES | O=P1(c2ccccc2)c2ccccc2-c2cc3c(-c4ccccc4)c4cc5c(cc4c(-c4ccccc4)c3cc21)[P+](O)(c1ccccc1)c1ccccc1-5 |
| InChI | InChI=1S/C50H33O2P2/c51-53(35-21-9-3-10-22-35)45-27-15-13-25-37(45)39-29-41-43(31-47(39)53)50(34-19-7-2-8-20-34)44-32-48-40(30-42(44)49(41)33-17-5-1-6-18-33)38-26-14-16-28-46(38)54(48,52)36-23-11-4-12-24-36/h1-32,51H/q+1 |
| InChIKey | WCFMYDXVOURNTE-UHFFFAOYSA-N |
| XLogP | 10.13 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 727.76 |
| LogP ≤ 5 | 10.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|