About 2-chloro-3,4-diethylpyridine
2-chloro-3,4-diethylpyridine (PubChem CID 91256664) has the molecular formula C9H12ClN
and a molecular weight of 169.66 g/mol. Its IUPAC name is 2-chloro-3,4-diethylpyridine.
Molecular Properties
| Compound Name | 2-chloro-3,4-diethylpyridine |
| PubChem CID | 91256664 |
| Molecular Formula | C9H12ClN |
| Molecular Weight | 169.66 g/mol |
| Exact Mass | 169.07 |
| IUPAC Name | 2-chloro-3,4-diethylpyridine |
| SMILES | CCc1ccnc(Cl)c1CC |
| InChI | InChI=1S/C9H12ClN/c1-3-7-5-6-11-9(10)8(7)4-2/h5-6H,3-4H2,1-2H3 |
| InChIKey | NPMCKBBVDGOURN-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 169.66 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 2-chloro-3,4-diethylpyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-3,4-diethylpyridine?
The IUPAC name of 2-chloro-3,4-diethylpyridine (CID 91256664) is 2-chloro-3,4-diethylpyridine.
What is the SMILES notation for 2-chloro-3,4-diethylpyridine?
The canonical SMILES for 2-chloro-3,4-diethylpyridine is CCc1ccnc(Cl)c1CC.
What is the InChIKey of 2-chloro-3,4-diethylpyridine?
The InChIKey is NPMCKBBVDGOURN-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12ClN/c1-3-7-5-6-11-9(10)8(7)4-2/h5-6H,3-4H2,1-2H3.
What are the key properties of 2-chloro-3,4-diethylpyridine?
2-chloro-3,4-diethylpyridine has a molecular weight of 169.66 g/mol, XLogP of 2.86, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-3,4-diethylpyridine is sourced from PubChem (CID 91256664), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).