C12H17NO — CID 91256981
2-hydroxy-1,1,3,3-tetrakis(trideuteriomethyl)isoindole (PubChem CID 91256981) has the molecular formula C12H17NO and a molecular weight of 203.35 g/mol. Its IUPAC name is 2-hydroxy-1,1,3,3-tetrakis(trideuteriomethyl)isoindole.
| Compound Name | 2-hydroxy-1,1,3,3-tetrakis(trideuteriomethyl)isoindole |
|---|---|
| PubChem CID | 91256981 |
| Molecular Formula | C12H17NO |
| Molecular Weight | 203.35 g/mol |
| Exact Mass | 203.21 |
| IUPAC Name | 2-hydroxy-1,1,3,3-tetrakis(trideuteriomethyl)isoindole |
| SMILES | [2H]C([2H])([2H])C1(C([2H])([2H])[2H])c2ccccc2C(C([2H])([2H])[2H])(C([2H])([2H])[2H])N1O |
| InChI | InChI=1S/C12H17NO/c1-11(2)9-7-5-6-8-10(9)12(3,4)13(11)14/h5-8,14H,1-4H3/i1D3,2D3,3D3,4D3 |
| InChIKey | YLUNMWQQDYDAJP-MGKWXGLJSA-N |
| XLogP | 2.86 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.35 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |