About 3aH-benzimidazole;ethane
3aH-benzimidazole;ethane (PubChem CID 91257109) has the molecular formula C9H12N2
and a molecular weight of 148.21 g/mol. Its IUPAC name is 3aH-benzimidazole;ethane.
Molecular Properties
| Compound Name | 3aH-benzimidazole;ethane |
| PubChem CID | 91257109 |
| Molecular Formula | C9H12N2 |
| Molecular Weight | 148.21 g/mol |
| Exact Mass | 148.10 |
| IUPAC Name | 3aH-benzimidazole;ethane |
| SMILES | C1=CC2=NC=NC2C=C1.CC |
| InChI | InChI=1S/C7H6N2.C2H6/c1-2-4-7-6(3-1)8-5-9-7;1-2/h1-6H;1-2H3 |
| InChIKey | BBIRIDRJTDRGNI-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 148.21 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3aH-benzimidazole;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3aH-benzimidazole;ethane?
The IUPAC name of 3aH-benzimidazole;ethane (CID 91257109) is 3aH-benzimidazole;ethane.
What is the SMILES notation for 3aH-benzimidazole;ethane?
The canonical SMILES for 3aH-benzimidazole;ethane is C1=CC2=NC=NC2C=C1.CC.
What is the InChIKey of 3aH-benzimidazole;ethane?
The InChIKey is BBIRIDRJTDRGNI-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6N2.C2H6/c1-2-4-7-6(3-1)8-5-9-7;1-2/h1-6H;1-2H3.
What are the key properties of 3aH-benzimidazole;ethane?
3aH-benzimidazole;ethane has a molecular weight of 148.21 g/mol, XLogP of 1.99, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3aH-benzimidazole;ethane is sourced from PubChem (CID 91257109), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).