About 3-prop-2-enoxypropan-1-ol;tris(prop-2-enyl) benzene-1,3,5-tricarboxylate
3-prop-2-enoxypropan-1-ol;tris(prop-2-enyl) benzene-1,3,5-tricarboxylate (PubChem CID 91257427) has the molecular formula C24H30O8
and a molecular weight of 446.50 g/mol. Its IUPAC name is 3-prop-2-enoxypropan-1-ol;tris(prop-2-enyl) benzene-1,3,5-tricarboxylate.
Molecular Properties
| Compound Name | 3-prop-2-enoxypropan-1-ol;tris(prop-2-enyl) benzene-1,3,5-tricarboxylate |
| PubChem CID | 91257427 |
| Molecular Formula | C24H30O8 |
| Molecular Weight | 446.50 g/mol |
| Exact Mass | 446.19 |
| IUPAC Name | 3-prop-2-enoxypropan-1-ol;tris(prop-2-enyl) benzene-1,3,5-tricarboxylate |
| SMILES | C=CCOC(=O)c1cc(C(=O)OCC=C)cc(C(=O)OCC=C)c1.C=CCOCCCO |
| InChI | InChI=1S/C18H18O6.C6H12O2/c1-4-7-22-16(19)13-10-14(17(20)23-8-5-2)12-15(11-13)18(21)24-9-6-3;1-2-5-8-6-3-4-7/h4-6,10-12H,1-3,7-9H2;2,7H,1,3-6H2 |
| InChIKey | LAXSBJQCXYEMAT-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 108.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 446.50 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 3-prop-2-enoxypropan-1-ol;tris(prop-2-enyl) benzene-1,3,5-tricarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-prop-2-enoxypropan-1-ol;tris(prop-2-enyl) benzene-1,3,5-tricarboxylate?
The IUPAC name of 3-prop-2-enoxypropan-1-ol;tris(prop-2-enyl) benzene-1,3,5-tricarboxylate (CID 91257427) is 3-prop-2-enoxypropan-1-ol;tris(prop-2-enyl) benzene-1,3,5-tricarboxylate.
What is the SMILES notation for 3-prop-2-enoxypropan-1-ol;tris(prop-2-enyl) benzene-1,3,5-tricarboxylate?
The canonical SMILES for 3-prop-2-enoxypropan-1-ol;tris(prop-2-enyl) benzene-1,3,5-tricarboxylate is C=CCOC(=O)c1cc(C(=O)OCC=C)cc(C(=O)OCC=C)c1.C=CCOCCCO.
What is the InChIKey of 3-prop-2-enoxypropan-1-ol;tris(prop-2-enyl) benzene-1,3,5-tricarboxylate?
The InChIKey is LAXSBJQCXYEMAT-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H18O6.C6H12O2/c1-4-7-22-16(19)13-10-14(17(20)23-8-5-2)12-15(11-13)18(21)24-9-6-3;1-2-5-8-6-3-4-7/h4-6,10-12H,1-3,7-9H2;2,7H,1,3-6H2.
What are the key properties of 3-prop-2-enoxypropan-1-ol;tris(prop-2-enyl) benzene-1,3,5-tricarboxylate?
3-prop-2-enoxypropan-1-ol;tris(prop-2-enyl) benzene-1,3,5-tricarboxylate has a molecular weight of 446.50 g/mol, XLogP of 3.29, 14 rotatable bonds, 1 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 3-prop-2-enoxypropan-1-ol;tris(prop-2-enyl) benzene-1,3,5-tricarboxylate is sourced from PubChem (CID 91257427), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).