C21H31NO — CID 91257702
(12aS)-8,12a-dimethyl-1,3,4,4a,4b,5,6,10b,11,12-decahydronaphtho[2,1-f]quinolin-2-one;ethane (PubChem CID 91257702) has the molecular formula C21H31NO and a molecular weight of 313.49 g/mol. Its IUPAC name is (12aS)-8,12a-dimethyl-1,3,4,4a,4b,5,6,10b,11,12-decahydronaphtho[2,1-f]quinolin-2-one;ethane.
| Compound Name | (12aS)-8,12a-dimethyl-1,3,4,4a,4b,5,6,10b,11,12-decahydronaphtho[2,1-f]quinolin-2-one;ethane |
|---|---|
| PubChem CID | 91257702 |
| Molecular Formula | C21H31NO |
| Molecular Weight | 313.49 g/mol |
| Exact Mass | 313.24 |
| IUPAC Name | (12aS)-8,12a-dimethyl-1,3,4,4a,4b,5,6,10b,11,12-decahydronaphtho[2,1-f]quinolin-2-one;ethane |
| SMILES | CC.Cc1ccc2c(c1)CCC1C2CC[C@]2(C)NC(=O)CCC12 |
| InChI | InChI=1S/C19H25NO.C2H6/c1-12-3-5-14-13(11-12)4-6-16-15(14)9-10-19(2)17(16)7-8-18(21)20-19;1-2/h3,5,11,15-17H,4,6-10H2,1-2H3,(H,20,21);1-2H3/t15?,16?,17?,19-;/m0./s1 |
| InChIKey | UFTUUZHSRTUNQL-WWRDJJIBSA-N |
| XLogP | 4.75 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.49 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |