C25H29ClN4O2S — CID 91257824
N-[(4-chlorophenyl)methyl]-8-[(4-propan-2-ylphenyl)carbamothioyl]-1-oxa-2,8-diazaspiro[4.5]dec-3-ene-3-carboxamide (PubChem CID 91257824) has the molecular formula C25H29ClN4O2S and a molecular weight of 485.05 g/mol. Its IUPAC name is N-[(4-chlorophenyl)methyl]-8-[(4-propan-2-ylphenyl)carbamothioyl]-1-oxa-2,8-diazaspiro[4.5]dec-3-ene-3-carboxamide.
| Compound Name | N-[(4-chlorophenyl)methyl]-8-[(4-propan-2-ylphenyl)carbamothioyl]-1-oxa-2,8-diazaspiro[4.5]dec-3-ene-3-carboxamide |
|---|---|
| PubChem CID | 91257824 |
| Molecular Formula | C25H29ClN4O2S |
| Molecular Weight | 485.05 g/mol |
| Exact Mass | 484.17 |
| IUPAC Name | N-[(4-chlorophenyl)methyl]-8-[(4-propan-2-ylphenyl)carbamothioyl]-1-oxa-2,8-diazaspiro[4.5]dec-3-ene-3-carboxamide |
| SMILES | CC(C)c1ccc(NC(=S)N2CCC3(C=C(C(=O)NCc4ccc(Cl)cc4)NO3)CC2)cc1 |
| InChI | InChI=1S/C25H29ClN4O2S/c1-17(2)19-5-9-21(10-6-19)28-24(33)30-13-11-25(12-14-30)15-22(29-32-25)23(31)27-16-18-3-7-20(26)8-4-18/h3-10,15,17,29H,11-14,16H2,1-2H3,(H,27,31)(H,28,33) |
| InChIKey | AAHOLHZMRMCIJA-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 65.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.05 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|