C20H37NO — CID 91257846
5-(1-cyclopropylethyl)-3-methyl-3-(2,3,4,7-tetrahydro-1H-azepin-4-yl)octan-4-ol (PubChem CID 91257846) has the molecular formula C20H37NO and a molecular weight of 307.52 g/mol. Its IUPAC name is 5-(1-cyclopropylethyl)-3-methyl-3-(2,3,4,7-tetrahydro-1H-azepin-4-yl)octan-4-ol.
| Compound Name | 5-(1-cyclopropylethyl)-3-methyl-3-(2,3,4,7-tetrahydro-1H-azepin-4-yl)octan-4-ol |
|---|---|
| PubChem CID | 91257846 |
| Molecular Formula | C20H37NO |
| Molecular Weight | 307.52 g/mol |
| Exact Mass | 307.29 |
| IUPAC Name | 5-(1-cyclopropylethyl)-3-methyl-3-(2,3,4,7-tetrahydro-1H-azepin-4-yl)octan-4-ol |
| SMILES | CCCC(C(C)C1CC1)C(O)C(C)(CC)C1C=CCNCC1 |
| InChI | InChI=1S/C20H37NO/c1-5-8-18(15(3)16-10-11-16)19(22)20(4,6-2)17-9-7-13-21-14-12-17/h7,9,15-19,21-22H,5-6,8,10-14H2,1-4H3 |
| InChIKey | XUXBZDQKDNGFDR-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.52 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|