C22H34FN3O5 — CID 91257888
(2S,3S)-3-[(2R)-2-(3-fluoro-2-propan-2-yloxyphenyl)-2-methylpiperazine-1-carbonyl]-N,2-dihydroxy-5-methylhexanamide (PubChem CID 91257888) has the molecular formula C22H34FN3O5 and a molecular weight of 439.53 g/mol. Its IUPAC name is (2S,3S)-3-[(2R)-2-(3-fluoro-2-propan-2-yloxyphenyl)-2-methylpiperazine-1-carbonyl]-N,2-dihydroxy-5-methylhexanamide.
| Compound Name | (2S,3S)-3-[(2R)-2-(3-fluoro-2-propan-2-yloxyphenyl)-2-methylpiperazine-1-carbonyl]-N,2-dihydroxy-5-methylhexanamide |
|---|---|
| PubChem CID | 91257888 |
| Molecular Formula | C22H34FN3O5 |
| Molecular Weight | 439.53 g/mol |
| Exact Mass | 439.25 |
| IUPAC Name | (2S,3S)-3-[(2R)-2-(3-fluoro-2-propan-2-yloxyphenyl)-2-methylpiperazine-1-carbonyl]-N,2-dihydroxy-5-methylhexanamide |
| SMILES | CC(C)C[C@H](C(=O)N1CCNC[C@@]1(C)c1cccc(F)c1OC(C)C)[C@H](O)C(=O)NO |
| InChI | InChI=1S/C22H34FN3O5/c1-13(2)11-15(18(27)20(28)25-30)21(29)26-10-9-24-12-22(26,5)16-7-6-8-17(23)19(16)31-14(3)4/h6-8,13-15,18,24,27,30H,9-12H2,1-5H3,(H,25,28)/t15-,18-,22-/m0/s1 |
| InChIKey | NETQWORXQILDCS-VPKVUBIPSA-N |
| XLogP | 1.79 |
| TPSA | 111.13 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.53 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|