C15H13N3O — CID 912581
5-(3,5-dimethylphenyl)-3-pyridin-4-yl-1,2,4-oxadiazole (PubChem CID 912581) has the molecular formula C15H13N3O and a molecular weight of 251.29 g/mol. Its IUPAC name is 5-(3,5-dimethylphenyl)-3-pyridin-4-yl-1,2,4-oxadiazole.
| Compound Name | 5-(3,5-dimethylphenyl)-3-pyridin-4-yl-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 912581 |
| Molecular Formula | C15H13N3O |
| Molecular Weight | 251.29 g/mol |
| Exact Mass | 251.11 |
| IUPAC Name | 5-(3,5-dimethylphenyl)-3-pyridin-4-yl-1,2,4-oxadiazole |
| SMILES | Cc1cc(C)cc(-c2nc(-c3ccncc3)no2)c1 |
| InChI | InChI=1S/C15H13N3O/c1-10-7-11(2)9-13(8-10)15-17-14(18-19-15)12-3-5-16-6-4-12/h3-9H,1-2H3 |
| InChIKey | ITLHDBTVPBSEPI-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 51.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.29 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |