C30H24O6 — CID 91258592
4-[3,5-bis(4-carboxyphenyl)-2,4,6-trimethylphenyl]benzoic acid (PubChem CID 91258592) has the molecular formula C30H24O6 and a molecular weight of 480.52 g/mol. Its IUPAC name is 4-[3,5-bis(4-carboxyphenyl)-2,4,6-trimethylphenyl]benzoic acid.
| Compound Name | 4-[3,5-bis(4-carboxyphenyl)-2,4,6-trimethylphenyl]benzoic acid |
|---|---|
| PubChem CID | 91258592 |
| Molecular Formula | C30H24O6 |
| Molecular Weight | 480.52 g/mol |
| Exact Mass | 480.16 |
| IUPAC Name | 4-[3,5-bis(4-carboxyphenyl)-2,4,6-trimethylphenyl]benzoic acid |
| SMILES | Cc1c(-c2ccc(C(=O)O)cc2)c(C)c(-c2ccc(C(=O)O)cc2)c(C)c1-c1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C30H24O6/c1-16-25(19-4-10-22(11-5-19)28(31)32)17(2)27(21-8-14-24(15-9-21)30(35)36)18(3)26(16)20-6-12-23(13-7-20)29(33)34/h4-15H,1-3H3,(H,31,32)(H,33,34)(H,35,36) |
| InChIKey | PBPZGWJKXHZWFE-UHFFFAOYSA-N |
| XLogP | 6.71 |
| TPSA | 111.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.52 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |